C34H25N3 — CID 169071903
2-(1,1,2,2,2-pentadeuterioethyl)-1-[10-(2-pyridin-4-ylphenyl)anthracen-9-yl]benzimidazole (PubChem CID 169071903) has the molecular formula C34H25N3 and a molecular weight of 480.63 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentadeuterioethyl)-1-[10-(2-pyridin-4-ylphenyl)anthracen-9-yl]benzimidazole.
| Compound Name | 2-(1,1,2,2,2-pentadeuterioethyl)-1-[10-(2-pyridin-4-ylphenyl)anthracen-9-yl]benzimidazole |
|---|---|
| PubChem CID | 169071903 |
| Molecular Formula | C34H25N3 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 2-(1,1,2,2,2-pentadeuterioethyl)-1-[10-(2-pyridin-4-ylphenyl)anthracen-9-yl]benzimidazole |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1nc2ccccc2n1-c1c2ccccc2c(-c2ccccc2-c2ccncc2)c2ccccc12 |
| InChI | InChI=1S/C34H25N3/c1-2-32-36-30-17-9-10-18-31(30)37(32)34-28-15-7-5-13-26(28)33(27-14-6-8-16-29(27)34)25-12-4-3-11-24(25)23-19-21-35-22-20-23/h3-22H,2H2,1H3/i1D3,2D2 |
| InChIKey | WVJXYHQXGLAJTM-ZBJDZAJPSA-N |
| XLogP | 8.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|