C9H17N3 — CID 139357837
(Z)-3-imino-2-(2-methylpiperidin-3-yl)prop-1-en-1-amine (PubChem CID 139357837) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (Z)-3-imino-2-(2-methylpiperidin-3-yl)prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-2-(2-methylpiperidin-3-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 139357837 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (Z)-3-imino-2-(2-methylpiperidin-3-yl)prop-1-en-1-amine |
| SMILES | [H]/N=C/C(=C\N)C1CCCNC1C |
| InChI | InChI=1S/C9H17N3/c1-7-9(3-2-4-12-7)8(5-10)6-11/h5-7,9-10,12H,2-4,11H2,1H3/b8-6+,10-5+ |
| InChIKey | OPURJXNAIDCNEE-SOYUKNQTSA-N |
| XLogP | 0.87 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|