C16H17N7OS — CID 139358030
3-[4-(3-sulfanylpiperidin-1-yl)pyrimidin-2-yl]imidazo[1,2-a]pyrazine-6-carboxamide (PubChem CID 139358030) has the molecular formula C16H17N7OS and a molecular weight of 355.43 g/mol. Its IUPAC name is 3-[4-(3-sulfanylpiperidin-1-yl)pyrimidin-2-yl]imidazo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | 3-[4-(3-sulfanylpiperidin-1-yl)pyrimidin-2-yl]imidazo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 139358030 |
| Molecular Formula | C16H17N7OS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-[4-(3-sulfanylpiperidin-1-yl)pyrimidin-2-yl]imidazo[1,2-a]pyrazine-6-carboxamide |
| SMILES | NC(=O)c1cn2c(-c3nccc(N4CCCC(S)C4)n3)cnc2cn1 |
| InChI | InChI=1S/C16H17N7OS/c17-15(24)11-9-23-12(6-20-14(23)7-19-11)16-18-4-3-13(21-16)22-5-1-2-10(25)8-22/h3-4,6-7,9-10,25H,1-2,5,8H2,(H2,17,24) |
| InChIKey | NVKDELRBKGGPGC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|