C8H10N2S — CID 139358445
5-(1,2,3,6-tetrahydropyridin-5-yl)-1,3-thiazole (PubChem CID 139358445) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 5-(1,2,3,6-tetrahydropyridin-5-yl)-1,3-thiazole.
| Compound Name | 5-(1,2,3,6-tetrahydropyridin-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 139358445 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 5-(1,2,3,6-tetrahydropyridin-5-yl)-1,3-thiazole |
| SMILES | C1=C(c2cncs2)CNCC1 |
| InChI | InChI=1S/C8H10N2S/c1-2-7(4-9-3-1)8-5-10-6-11-8/h2,5-6,9H,1,3-4H2 |
| InChIKey | NIBYQOILBHPDLV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |