C15H20N6O — CID 139358723
2-[1-[2-(2-methanimidoyl-1H-imidazol-5-yl)pyrimidin-4-yl]piperidin-3-yl]ethanol (PubChem CID 139358723) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-[1-[2-(2-methanimidoyl-1H-imidazol-5-yl)pyrimidin-4-yl]piperidin-3-yl]ethanol.
| Compound Name | 2-[1-[2-(2-methanimidoyl-1H-imidazol-5-yl)pyrimidin-4-yl]piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 139358723 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[1-[2-(2-methanimidoyl-1H-imidazol-5-yl)pyrimidin-4-yl]piperidin-3-yl]ethanol |
| SMILES | [H]/N=C/c1ncc(-c2nccc(N3CCCC(CCO)C3)n2)[nH]1 |
| InChI | InChI=1S/C15H20N6O/c16-8-13-18-9-12(19-13)15-17-5-3-14(20-15)21-6-1-2-11(10-21)4-7-22/h3,5,8-9,11,16,22H,1-2,4,6-7,10H2,(H,18,19)/b16-8+ |
| InChIKey | ZQZYJNJINLSLQR-LZYBPNLTSA-N |
| XLogP | 1.46 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|