About N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine
N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 139362561) has the molecular formula C11H27N5
and a molecular weight of 229.37 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine |
| PubChem CID | 139362561 |
| Molecular Formula | C11H27N5 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.23 |
| IUPAC Name | N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | NCCN(CCN)CCN1CCC(N)CC1 |
| InChI | InChI=1S/C11H27N5/c12-3-7-16(8-4-13)10-9-15-5-1-11(14)2-6-15/h11H,1-10,12-14H2 |
| InChIKey | XDCYQTXFYYDXBL-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine?
The IUPAC name of N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine (CID 139362561) is N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine.
What is the SMILES notation for N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine?
The canonical SMILES for N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine is NCCN(CCN)CCN1CCC(N)CC1.
What is the InChIKey of N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine?
The InChIKey is XDCYQTXFYYDXBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N5/c12-3-7-16(8-4-13)10-9-15-5-1-11(14)2-6-15/h11H,1-10,12-14H2.
What are the key properties of N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine?
N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine has a molecular weight of 229.37 g/mol, XLogP of -1.37, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminoethyl)-N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine is sourced from PubChem (CID 139362561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).