C9H22N4 — CID 145422276
N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 145422276) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 145422276 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | N'-[2-(4-aminopiperidin-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCN1CCC(N)CC1 |
| InChI | InChI=1S/C9H22N4/c10-3-4-12-5-8-13-6-1-9(11)2-7-13/h9,12H,1-8,10-11H2 |
| InChIKey | HQTPONYWGZXFIA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|