C13H30N6 — CID 167027437
4-N-[2-[2-(3-aminopyrrolidin-1-yl)ethylamino]ethyl]piperidine-1,4-diamine (PubChem CID 167027437) has the molecular formula C13H30N6 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-N-[2-[2-(3-aminopyrrolidin-1-yl)ethylamino]ethyl]piperidine-1,4-diamine.
| Compound Name | 4-N-[2-[2-(3-aminopyrrolidin-1-yl)ethylamino]ethyl]piperidine-1,4-diamine |
|---|---|
| PubChem CID | 167027437 |
| Molecular Formula | C13H30N6 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.25 |
| IUPAC Name | 4-N-[2-[2-(3-aminopyrrolidin-1-yl)ethylamino]ethyl]piperidine-1,4-diamine |
| SMILES | NC1CCN(CCNCCNC2CCN(N)CC2)C1 |
| InChI | InChI=1S/C13H30N6/c14-12-1-7-18(11-12)10-6-16-4-5-17-13-2-8-19(15)9-3-13/h12-13,16-17H,1-11,14-15H2 |
| InChIKey | QEMGYGLLFVSCCY-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|