C29H30F3N7O2 — CID 139362699
4,4,4-trifluoro-1-[4-[2-[4-[hydroxy-(2-pyridin-2-ylethylamino)methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one (PubChem CID 139362699) has the molecular formula C29H30F3N7O2 and a molecular weight of 565.60 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-[2-[4-[hydroxy-(2-pyridin-2-ylethylamino)methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[4-[2-[4-[hydroxy-(2-pyridin-2-ylethylamino)methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 139362699 |
| Molecular Formula | C29H30F3N7O2 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-[2-[4-[hydroxy-(2-pyridin-2-ylethylamino)methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1CC=C(c2cccn3nc(Nc4ccc(C(O)NCCc5ccccn5)cc4)nc23)CC1 |
| InChI | InChI=1S/C29H30F3N7O2/c30-29(31,32)14-10-25(40)38-18-12-20(13-19-38)24-5-3-17-39-26(24)36-28(37-39)35-23-8-6-21(7-9-23)27(41)34-16-11-22-4-1-2-15-33-22/h1-9,12,15,17,27,34,41H,10-11,13-14,16,18-19H2,(H,35,37) |
| InChIKey | GOHMEJAWGRKSSM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|