C18H23F3N4O — CID 144801777
ethane;4,4,4-trifluoro-1-[4-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one (PubChem CID 144801777) has the molecular formula C18H23F3N4O and a molecular weight of 368.40 g/mol. Its IUPAC name is ethane;4,4,4-trifluoro-1-[4-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one.
| Compound Name | ethane;4,4,4-trifluoro-1-[4-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 144801777 |
| Molecular Formula | C18H23F3N4O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethane;4,4,4-trifluoro-1-[4-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
| SMILES | CC.Cc1nc2c(C3=CCN(C(=O)CCC(F)(F)F)CC3)cccn2n1 |
| InChI | InChI=1S/C16H17F3N4O.C2H6/c1-11-20-15-13(3-2-8-23(15)21-11)12-5-9-22(10-6-12)14(24)4-7-16(17,18)19;1-2/h2-3,5,8H,4,6-7,9-10H2,1H3;1-2H3 |
| InChIKey | CAGHMAIKDFFMEZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |