C30H32F3N7O2 — CID 139362612
4,4,4-trifluoro-1-[4-[2-[4-[hydroxy-[2-(6-methyl-2-pyridinyl)ethylamino]methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one (PubChem CID 139362612) has the molecular formula C30H32F3N7O2 and a molecular weight of 579.63 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-[2-[4-[hydroxy-[2-(6-methyl-2-pyridinyl)ethylamino]methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[4-[2-[4-[hydroxy-[2-(6-methyl-2-pyridinyl)ethylamino]methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 139362612 |
| Molecular Formula | C30H32F3N7O2 |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-[2-[4-[hydroxy-[2-(6-methyl-2-pyridinyl)ethylamino]methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
| SMILES | Cc1cccc(CCNC(O)c2ccc(Nc3nc4c(C5=CCN(C(=O)CCC(F)(F)F)CC5)cccn4n3)cc2)n1 |
| InChI | InChI=1S/C30H32F3N7O2/c1-20-4-2-5-23(35-20)12-16-34-28(42)22-7-9-24(10-8-22)36-29-37-27-25(6-3-17-40(27)38-29)21-13-18-39(19-14-21)26(41)11-15-30(31,32)33/h2-10,13,17,28,34,42H,11-12,14-16,18-19H2,1H3,(H,36,38) |
| InChIKey | WOCXRVQMFOHVOD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|