C48H101N7O2 — CID 139363231
N-[2-[4-[(6R)-6-[3-[2-(tert-butylamino)ethoxy]propoxy]-3,3,7,7-tetramethyloctyl]piperazin-1-yl]ethyl]-7-[4-[3-(tert-butylamino)propyl]piperazin-1-yl]-2,5,5-trimethylheptan-2-amine (PubChem CID 139363231) has the molecular formula C48H101N7O2 and a molecular weight of 808.38 g/mol. Its IUPAC name is N-[2-[4-[(6R)-6-[3-[2-(tert-butylamino)ethoxy]propoxy]-3,3,7,7-tetramethyloctyl]piperazin-1-yl]ethyl]-7-[4-[3-(tert-butylamino)propyl]piperazin-1-yl]-2,5,5-trimethylheptan-2-amine.
| Compound Name | N-[2-[4-[(6R)-6-[3-[2-(tert-butylamino)ethoxy]propoxy]-3,3,7,7-tetramethyloctyl]piperazin-1-yl]ethyl]-7-[4-[3-(tert-butylamino)propyl]piperazin-1-yl]-2,5,5-trimethylheptan-2-amine |
|---|---|
| PubChem CID | 139363231 |
| Molecular Formula | C48H101N7O2 |
| Molecular Weight | 808.38 g/mol |
| Exact Mass | 807.80 |
| IUPAC Name | N-[2-[4-[(6R)-6-[3-[2-(tert-butylamino)ethoxy]propoxy]-3,3,7,7-tetramethyloctyl]piperazin-1-yl]ethyl]-7-[4-[3-(tert-butylamino)propyl]piperazin-1-yl]-2,5,5-trimethylheptan-2-amine |
| SMILES | CC(C)(CC[C@@H](OCCCOCCNC(C)(C)C)C(C)(C)C)CCN1CCN(CCNC(C)(C)CCC(C)(C)CCN2CCN(CCCNC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C48H101N7O2/c1-43(2,3)42(57-40-17-39-56-41-26-50-45(7,8)9)18-19-46(10,11)22-28-53-35-37-55(38-36-53)30-25-51-48(14,15)21-20-47(12,13)23-29-54-33-31-52(32-34-54)27-16-24-49-44(4,5)6/h42,49-51H,16-41H2,1-15H3/t42-/m1/s1 |
| InChIKey | QDZBZTOADWRIDF-HUESYALOSA-N |
| XLogP | 7.99 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.38 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|