C19H18F3N7O — CID 139366002
4-[5-(1H-indazol-5-ylamino)-1-methyl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 139366002) has the molecular formula C19H18F3N7O and a molecular weight of 417.40 g/mol. Its IUPAC name is 4-[5-(1H-indazol-5-ylamino)-1-methyl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4-[5-(1H-indazol-5-ylamino)-1-methyl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 139366002 |
| Molecular Formula | C19H18F3N7O |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[5-(1H-indazol-5-ylamino)-1-methyl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | Cn1nc(C2=CC=C(C(=O)NCC(F)(F)F)CC2)nc1Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C19H18F3N7O/c1-29-18(25-14-6-7-15-13(8-14)9-24-27-15)26-16(28-29)11-2-4-12(5-3-11)17(30)23-10-19(20,21)22/h2,4,6-9H,3,5,10H2,1H3,(H,23,30)(H,24,27)(H,25,26,28) |
| InChIKey | QXLCIVSGLIUWDE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |