About 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide
3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide (PubChem CID 139367957) has the molecular formula C21H30N2O3
and a molecular weight of 358.48 g/mol. Its IUPAC name is 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide.
Molecular Properties
| Compound Name | 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide |
| PubChem CID | 139367957 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide |
| SMILES | COC1(c2cccc(C(N)=O)c2)[C@@H]2CCC[C@H]1CN(C1CCCOC1)C2 |
| InChI | InChI=1S/C21H30N2O3/c1-25-21(16-6-2-5-15(11-16)20(22)24)17-7-3-8-18(21)13-23(12-17)19-9-4-10-26-14-19/h2,5-6,11,17-19H,3-4,7-10,12-14H2,1H3,(H2,22,24)/t17-,18+,19?,21? |
| InChIKey | HBFWYKLLZUTBRH-FUUYNRHESA-N |
| XLogP | 2.54 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The IUPAC name of 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide (CID 139367957) is 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide.
What is the SMILES notation for 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The canonical SMILES for 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide is COC1(c2cccc(C(N)=O)c2)[C@@H]2CCC[C@H]1CN(C1CCCOC1)C2.
What is the InChIKey of 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The InChIKey is HBFWYKLLZUTBRH-FUUYNRHESA-N. The full InChI is InChI=1S/C21H30N2O3/c1-25-21(16-6-2-5-15(11-16)20(22)24)17-7-3-8-18(21)13-23(12-17)19-9-4-10-26-14-19/h2,5-6,11,17-19H,3-4,7-10,12-14H2,1H3,(H2,22,24)/t17-,18+,19?,21?.
What are the key properties of 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide has a molecular weight of 358.48 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,5R)-9-methoxy-3-(oxan-3-yl)-3-azabicyclo[3.3.1]nonan-9-yl]benzamide is sourced from PubChem (CID 139367957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).