C83H71N5O — CID 139368622
2,3,5,6-tetrakis(1-tert-butylcarbazol-9-yl)-4-dibenzofuran-4-ylbenzonitrile (PubChem CID 139368622) has the molecular formula C83H71N5O and a molecular weight of 1154.52 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(1-tert-butylcarbazol-9-yl)-4-dibenzofuran-4-ylbenzonitrile.
| Compound Name | 2,3,5,6-tetrakis(1-tert-butylcarbazol-9-yl)-4-dibenzofuran-4-ylbenzonitrile |
|---|---|
| PubChem CID | 139368622 |
| Molecular Formula | C83H71N5O |
| Molecular Weight | 1154.52 g/mol |
| Exact Mass | 1153.57 |
| IUPAC Name | 2,3,5,6-tetrakis(1-tert-butylcarbazol-9-yl)-4-dibenzofuran-4-ylbenzonitrile |
| SMILES | CC(C)(C)c1cccc2c3ccccc3n(-c3c(C#N)c(-n4c5ccccc5c5cccc(C(C)(C)C)c54)c(-n4c5ccccc5c5cccc(C(C)(C)C)c54)c(-c4cccc5c4oc4ccccc45)c3-n3c4ccccc4c4cccc(C(C)(C)C)c43)c12 |
| InChI | InChI=1S/C83H71N5O/c1-80(2,3)61-39-24-33-54-49-28-13-18-43-65(49)85(71(54)61)75-60(48-84)76(86-66-44-19-14-29-50(66)55-34-25-40-62(72(55)86)81(4,5)6)78(88-68-46-21-16-31-52(68)57-36-27-42-64(74(57)88)83(10,11)12)70(59-38-23-37-58-53-32-17-22-47-69(53)89-79(58)59)77(75)87-67-45-20-15-30-51(67)56-35-26-41-63(73(56)87)82(7,8)9/h13-47H,1-12H3 |
| InChIKey | UWNYZWKCWNVKOD-UHFFFAOYSA-N |
| XLogP | 22.70 |
| TPSA | 56.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1154.52 |
| LogP ≤ 5 | 22.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |