C52H38N4O2 — CID 139550395
2,5-bis([1]benzofuro[2,3-a]carbazol-12-yl)-4,6-ditert-butylbenzene-1,3-dicarbonitrile (PubChem CID 139550395) has the molecular formula C52H38N4O2 and a molecular weight of 750.90 g/mol. Its IUPAC name is 2,5-bis([1]benzofuro[2,3-a]carbazol-12-yl)-4,6-ditert-butylbenzene-1,3-dicarbonitrile.
| Compound Name | 2,5-bis([1]benzofuro[2,3-a]carbazol-12-yl)-4,6-ditert-butylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139550395 |
| Molecular Formula | C52H38N4O2 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.30 |
| IUPAC Name | 2,5-bis([1]benzofuro[2,3-a]carbazol-12-yl)-4,6-ditert-butylbenzene-1,3-dicarbonitrile |
| SMILES | CC(C)(C)c1c(C#N)c(-n2c3ccccc3c3ccc4c5ccccc5oc4c32)c(C#N)c(C(C)(C)C)c1-n1c2ccccc2c2ccc3c4ccccc4oc3c21 |
| InChI | InChI=1S/C52H38N4O2/c1-51(2,3)43-37(27-53)45(55-39-19-11-7-15-29(39)33-23-25-35-31-17-9-13-21-41(31)57-49(35)46(33)55)38(28-54)44(52(4,5)6)48(43)56-40-20-12-8-16-30(40)34-24-26-36-32-18-10-14-22-42(32)58-50(36)47(34)56/h7-26H,1-6H3 |
| InChIKey | CIAHJNWMIMQAJJ-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |