C15H14FNO3 — CID 139369211
methyl 3-(6-fluoroquinolin-8-yl)oxycyclobutane-1-carboxylate (PubChem CID 139369211) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is methyl 3-(6-fluoroquinolin-8-yl)oxycyclobutane-1-carboxylate.
| Compound Name | methyl 3-(6-fluoroquinolin-8-yl)oxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 139369211 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | methyl 3-(6-fluoroquinolin-8-yl)oxycyclobutane-1-carboxylate |
| SMILES | COC(=O)C1CC(Oc2cc(F)cc3cccnc23)C1 |
| InChI | InChI=1S/C15H14FNO3/c1-19-15(18)10-6-12(7-10)20-13-8-11(16)5-9-3-2-4-17-14(9)13/h2-5,8,10,12H,6-7H2,1H3 |
| InChIKey | DGSNHQWPYZJEKT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |