C24H33NO2 — CID 7065271
cis-quinolin-8-yl (3R,5S)-3,5-ditert-butylcyclohexane-1-carboxylate (PubChem CID 7065271) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is cis-quinolin-8-yl (3R,5S)-3,5-ditert-butylcyclohexane-1-carboxylate.
| Compound Name | cis-quinolin-8-yl (3R,5S)-3,5-ditert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7065271 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | cis-quinolin-8-yl (3R,5S)-3,5-ditert-butylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)[C@@H]1CC(C(=O)Oc2cccc3cccnc23)C[C@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C24H33NO2/c1-23(2,3)18-13-17(14-19(15-18)24(4,5)6)22(26)27-20-11-7-9-16-10-8-12-25-21(16)20/h7-12,17-19H,13-15H2,1-6H3/t17?,18-,19+ |
| InChIKey | VNRVPPLCYIPLRF-YQQQUEKLSA-N |
| XLogP | 6.26 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|