C20H16BrCl2N5O4S — CID 139371190
N-[2-bromo-4-chloro-6-(methoxycarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-(thietan-3-yloxy)pyrazole-5-carboxamide (PubChem CID 139371190) has the molecular formula C20H16BrCl2N5O4S and a molecular weight of 573.26 g/mol. Its IUPAC name is N-[2-bromo-4-chloro-6-(methoxycarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-(thietan-3-yloxy)pyrazole-5-carboxamide.
| Compound Name | N-[2-bromo-4-chloro-6-(methoxycarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-(thietan-3-yloxy)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 139371190 |
| Molecular Formula | C20H16BrCl2N5O4S |
| Molecular Weight | 573.26 g/mol |
| Exact Mass | 570.95 |
| IUPAC Name | N-[2-bromo-4-chloro-6-(methoxycarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-(thietan-3-yloxy)pyrazole-5-carboxamide |
| SMILES | CONC(=O)c1cc(Cl)cc(Br)c1NC(=O)c1cc(OC2CSC2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C20H16BrCl2N5O4S/c1-31-27-19(29)12-5-10(22)6-13(21)17(12)25-20(30)15-7-16(32-11-8-33-9-11)26-28(15)18-14(23)3-2-4-24-18/h2-7,11H,8-9H2,1H3,(H,25,30)(H,27,29) |
| InChIKey | FMFDVOQYFFLKCJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|