C13H13Cl2N3O — CID 139371774
[(3R)-3-aminopyrrolidin-1-yl]-(5,6-dichloro-1H-indol-2-yl)methanone (PubChem CID 139371774) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(5,6-dichloro-1H-indol-2-yl)methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(5,6-dichloro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 139371774 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(5,6-dichloro-1H-indol-2-yl)methanone |
| SMILES | N[C@@H]1CCN(C(=O)c2cc3cc(Cl)c(Cl)cc3[nH]2)C1 |
| InChI | InChI=1S/C13H13Cl2N3O/c14-9-3-7-4-12(17-11(7)5-10(9)15)13(19)18-2-1-8(16)6-18/h3-5,8,17H,1-2,6,16H2/t8-/m1/s1 |
| InChIKey | JQLNNHJVESCXDJ-MRVPVSSYSA-N |
| XLogP | 2.65 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |