C33H29F6N5O2 — CID 139373055
5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(5,6-dimethylbenzimidazol-1-yl)-4,4,4-trifluoro-1-hydroxybutyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 139373055) has the molecular formula C33H29F6N5O2 and a molecular weight of 641.62 g/mol. Its IUPAC name is 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(5,6-dimethylbenzimidazol-1-yl)-4,4,4-trifluoro-1-hydroxybutyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(5,6-dimethylbenzimidazol-1-yl)-4,4,4-trifluoro-1-hydroxybutyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 139373055 |
| Molecular Formula | C33H29F6N5O2 |
| Molecular Weight | 641.62 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(5,6-dimethylbenzimidazol-1-yl)-4,4,4-trifluoro-1-hydroxybutyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | Cc1cc2ncn(C(CC(F)(F)F)C(O)N[C@@H](Cc3cc(F)cc(F)c3)c3ncccc3-c3ccc(F)c(C(N)=O)c3)c2cc1C |
| InChI | InChI=1S/C33H29F6N5O2/c1-17-8-26-28(9-18(17)2)44(16-42-26)29(15-33(37,38)39)32(46)43-27(12-19-10-21(34)14-22(35)11-19)30-23(4-3-7-41-30)20-5-6-25(36)24(13-20)31(40)45/h3-11,13-14,16,27,29,32,43,46H,12,15H2,1-2H3,(H2,40,45)/t27-,29?,32?/m0/s1 |
| InChIKey | DKCOKZDDESGLEH-YWFSETAJSA-N |
| XLogP | 6.62 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.62 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|