C28H30N2 — CID 139374477
N-[2-(5-butyl-1H-indol-3-yl)-1-phenylprop-2-enyl]-3-methylaniline (PubChem CID 139374477) has the molecular formula C28H30N2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[2-(5-butyl-1H-indol-3-yl)-1-phenylprop-2-enyl]-3-methylaniline.
| Compound Name | N-[2-(5-butyl-1H-indol-3-yl)-1-phenylprop-2-enyl]-3-methylaniline |
|---|---|
| PubChem CID | 139374477 |
| Molecular Formula | C28H30N2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[2-(5-butyl-1H-indol-3-yl)-1-phenylprop-2-enyl]-3-methylaniline |
| SMILES | C=C(c1c[nH]c2ccc(CCCC)cc12)C(Nc1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C28H30N2/c1-4-5-11-22-15-16-27-25(18-22)26(19-29-27)21(3)28(23-12-7-6-8-13-23)30-24-14-9-10-20(2)17-24/h6-10,12-19,28-30H,3-5,11H2,1-2H3 |
| InChIKey | GLQNUQXMDFCWGK-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |