C23H20N2O3S — CID 86728635
1-(1H-indol-3-yl)-2-(3-methylsulfonylanilino)-2-phenylethanone (PubChem CID 86728635) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-(3-methylsulfonylanilino)-2-phenylethanone.
| Compound Name | 1-(1H-indol-3-yl)-2-(3-methylsulfonylanilino)-2-phenylethanone |
|---|---|
| PubChem CID | 86728635 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-(3-methylsulfonylanilino)-2-phenylethanone |
| SMILES | CS(=O)(=O)c1cccc(NC(C(=O)c2c[nH]c3ccccc23)c2ccccc2)c1 |
| InChI | InChI=1S/C23H20N2O3S/c1-29(27,28)18-11-7-10-17(14-18)25-22(16-8-3-2-4-9-16)23(26)20-15-24-21-13-6-5-12-19(20)21/h2-15,22,24-25H,1H3 |
| InChIKey | UICQQCSGNXGAAN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |