C29H32N2O4 — CID 86728918
1-(1H-indol-3-yl)-2-[3-methoxy-5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]anilino]-2-phenylethanone (PubChem CID 86728918) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-[3-methoxy-5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]anilino]-2-phenylethanone.
| Compound Name | 1-(1H-indol-3-yl)-2-[3-methoxy-5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]anilino]-2-phenylethanone |
|---|---|
| PubChem CID | 86728918 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-[3-methoxy-5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]anilino]-2-phenylethanone |
| SMILES | COc1cc(NC(C(=O)c2c[nH]c3ccccc23)c2ccccc2)cc(OCCOC(C)(C)C)c1 |
| InChI | InChI=1S/C29H32N2O4/c1-29(2,3)35-15-14-34-23-17-21(16-22(18-23)33-4)31-27(20-10-6-5-7-11-20)28(32)25-19-30-26-13-9-8-12-24(25)26/h5-13,16-19,27,30-31H,14-15H2,1-4H3 |
| InChIKey | YOEDVQZRECRYSL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|