C25H22N2O3 — CID 39912469
(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-1-(1H-indol-3-yl)-2-phenylethanone (PubChem CID 39912469) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-1-(1H-indol-3-yl)-2-phenylethanone.
| Compound Name | (2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-1-(1H-indol-3-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 39912469 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-1-(1H-indol-3-yl)-2-phenylethanone |
| SMILES | O=C(c1c[nH]c2ccccc12)[C@H](Nc1ccc2c(c1)OCCCO2)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O3/c28-25(20-16-26-21-10-5-4-9-19(20)21)24(17-7-2-1-3-8-17)27-18-11-12-22-23(15-18)30-14-6-13-29-22/h1-5,7-12,15-16,24,26-27H,6,13-14H2/t24-/m1/s1 |
| InChIKey | LWCJCNMMTJZDBO-XMMPIXPASA-N |
| XLogP | 5.37 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|