C29H47N3O6 — CID 139374547
bis(2-ethylhexyl) 1-(6-prop-2-ynoyloxyhexyl)triazole-4,5-dicarboxylate (PubChem CID 139374547) has the molecular formula C29H47N3O6 and a molecular weight of 533.71 g/mol. Its IUPAC name is bis(2-ethylhexyl) 1-(6-prop-2-ynoyloxyhexyl)triazole-4,5-dicarboxylate.
| Compound Name | bis(2-ethylhexyl) 1-(6-prop-2-ynoyloxyhexyl)triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 139374547 |
| Molecular Formula | C29H47N3O6 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | bis(2-ethylhexyl) 1-(6-prop-2-ynoyloxyhexyl)triazole-4,5-dicarboxylate |
| SMILES | C#CC(=O)OCCCCCCn1nnc(C(=O)OCC(CC)CCCC)c1C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C29H47N3O6/c1-6-11-17-23(8-3)21-37-28(34)26-27(29(35)38-22-24(9-4)18-12-7-2)32(31-30-26)19-15-13-14-16-20-36-25(33)10-5/h5,23-24H,6-9,11-22H2,1-4H3 |
| InChIKey | NQMBCKSWDADPHU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 109.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|