C7H11N3O2S — CID 139374899
[2-(dimethylamino)-1,3-thiazol-4-yl]methylcarbamic acid (PubChem CID 139374899) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is [2-(dimethylamino)-1,3-thiazol-4-yl]methylcarbamic acid.
| Compound Name | [2-(dimethylamino)-1,3-thiazol-4-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 139374899 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | [2-(dimethylamino)-1,3-thiazol-4-yl]methylcarbamic acid |
| SMILES | CN(C)c1nc(CNC(=O)O)cs1 |
| InChI | InChI=1S/C7H11N3O2S/c1-10(2)6-9-5(4-13-6)3-8-7(11)12/h4,8H,3H2,1-2H3,(H,11,12) |
| InChIKey | LTLZFJNDZZEGOP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |