C19H17F6N4O4S- — CID 139375742
1-[4-(sulfinatoamino)-3-(trifluoromethoxy)benzoyl]-4-[[3-(trifluoromethyl)-2-pyridinyl]methyl]piperazine (PubChem CID 139375742) has the molecular formula C19H17F6N4O4S- and a molecular weight of 511.42 g/mol. Its IUPAC name is 1-[4-(sulfinatoamino)-3-(trifluoromethoxy)benzoyl]-4-[[3-(trifluoromethyl)-2-pyridinyl]methyl]piperazine.
| Compound Name | 1-[4-(sulfinatoamino)-3-(trifluoromethoxy)benzoyl]-4-[[3-(trifluoromethyl)-2-pyridinyl]methyl]piperazine |
|---|---|
| PubChem CID | 139375742 |
| Molecular Formula | C19H17F6N4O4S- |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-[4-(sulfinatoamino)-3-(trifluoromethoxy)benzoyl]-4-[[3-(trifluoromethyl)-2-pyridinyl]methyl]piperazine |
| SMILES | O=C(c1ccc(NS(=O)[O-])c(OC(F)(F)F)c1)N1CCN(Cc2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H18F6N4O4S/c20-18(21,22)13-2-1-5-26-15(13)11-28-6-8-29(9-7-28)17(30)12-3-4-14(27-34(31)32)16(10-12)33-19(23,24)25/h1-5,10,27H,6-9,11H2,(H,31,32)/p-1 |
| InChIKey | HBJUQZPAHUFZSV-UHFFFAOYSA-M |
| XLogP | 3.16 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|