C19H18F5N3O4 — CID 121290910
[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-[4-(hydroperoxyamino)-3-(trifluoromethoxy)phenyl]methanone (PubChem CID 121290910) has the molecular formula C19H18F5N3O4 and a molecular weight of 447.36 g/mol. Its IUPAC name is [4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-[4-(hydroperoxyamino)-3-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-[4-(hydroperoxyamino)-3-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 121290910 |
| Molecular Formula | C19H18F5N3O4 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | [4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-[4-(hydroperoxyamino)-3-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(NOO)c(OC(F)(F)F)c1)N1CCN(Cc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H18F5N3O4/c20-14-3-1-13(15(21)10-14)11-26-5-7-27(8-6-26)18(28)12-2-4-16(25-31-29)17(9-12)30-19(22,23)24/h1-4,9-10,25,29H,5-8,11H2 |
| InChIKey | LIUHNRWUIPTGTN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|