C19H20FIN2O2 — CID 31792217
[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-(4-iodophenyl)methanone (PubChem CID 31792217) has the molecular formula C19H20FIN2O2 and a molecular weight of 454.28 g/mol. Its IUPAC name is [4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-(4-iodophenyl)methanone.
| Compound Name | [4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 31792217 |
| Molecular Formula | C19H20FIN2O2 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-(4-iodophenyl)methanone |
| SMILES | COc1ccc(F)cc1CN1CCN(C(=O)c2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C19H20FIN2O2/c1-25-18-7-4-16(20)12-15(18)13-22-8-10-23(11-9-22)19(24)14-2-5-17(21)6-3-14/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | WTAPOFIZAHRGHI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|