C32H50O6 — CID 139376983
(2Z)-2-(16-acetyloxy-3-hydroxy-11-methoxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid (PubChem CID 139376983) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is (2Z)-2-(16-acetyloxy-3-hydroxy-11-methoxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid.
| Compound Name | (2Z)-2-(16-acetyloxy-3-hydroxy-11-methoxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 139376983 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | (2Z)-2-(16-acetyloxy-3-hydroxy-11-methoxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid |
| SMILES | COC1CC2/C(=C(\CCC=C(C)C)C(=O)O)C(OC(C)=O)CC2(C)C2(C)CCC3C(C)C(O)CCC3(C)C12 |
| InChI | InChI=1S/C32H50O6/c1-18(2)10-9-11-21(29(35)36)27-23-16-25(37-8)28-30(5)14-13-24(34)19(3)22(30)12-15-31(28,6)32(23,7)17-26(27)38-20(4)33/h10,19,22-26,28,34H,9,11-17H2,1-8H3,(H,35,36)/b27-21- |
| InChIKey | AWZWIRDIVFUEOS-MEFGMAGPSA-N |
| XLogP | 6.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|