C31H47IO6 — CID 139474060
(2Z)-2-(16-acetyloxy-3-hydroxy-11-iodooxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid (PubChem CID 139474060) has the molecular formula C31H47IO6 and a molecular weight of 642.62 g/mol. Its IUPAC name is (2Z)-2-(16-acetyloxy-3-hydroxy-11-iodooxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid.
| Compound Name | (2Z)-2-(16-acetyloxy-3-hydroxy-11-iodooxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 139474060 |
| Molecular Formula | C31H47IO6 |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | (2Z)-2-(16-acetyloxy-3-hydroxy-11-iodooxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid |
| SMILES | CC(=O)OC1CC2(C)C(CC(OI)C3C4(C)CCC(O)C(C)C4CCC32C)/C1=C(\CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C31H47IO6/c1-17(2)9-8-10-20(28(35)36)26-22-15-24(38-32)27-29(5)13-12-23(34)18(3)21(29)11-14-30(27,6)31(22,7)16-25(26)37-19(4)33/h9,18,21-25,27,34H,8,10-16H2,1-7H3,(H,35,36)/b26-20- |
| InChIKey | OCNKIEUSUDQSTO-QOMWVZHYSA-N |
| XLogP | 7.04 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|