C40H45F3N8O4 — CID 139379283
2-methylpentan-2-yl N-[6-[4-[6-[4-(1,3-dihydropyrrolo[3,4-c]pyridine-2-carbonylamino)phenyl]-3-oxo-2-(2,2,2-trifluoroethyl)pyridazin-4-yl]indazol-1-yl]hexyl]carbamate (PubChem CID 139379283) has the molecular formula C40H45F3N8O4 and a molecular weight of 758.85 g/mol. Its IUPAC name is 2-methylpentan-2-yl N-[6-[4-[6-[4-(1,3-dihydropyrrolo[3,4-c]pyridine-2-carbonylamino)phenyl]-3-oxo-2-(2,2,2-trifluoroethyl)pyridazin-4-yl]indazol-1-yl]hexyl]carbamate.
| Compound Name | 2-methylpentan-2-yl N-[6-[4-[6-[4-(1,3-dihydropyrrolo[3,4-c]pyridine-2-carbonylamino)phenyl]-3-oxo-2-(2,2,2-trifluoroethyl)pyridazin-4-yl]indazol-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 139379283 |
| Molecular Formula | C40H45F3N8O4 |
| Molecular Weight | 758.85 g/mol |
| Exact Mass | 758.35 |
| IUPAC Name | 2-methylpentan-2-yl N-[6-[4-[6-[4-(1,3-dihydropyrrolo[3,4-c]pyridine-2-carbonylamino)phenyl]-3-oxo-2-(2,2,2-trifluoroethyl)pyridazin-4-yl]indazol-1-yl]hexyl]carbamate |
| SMILES | CCCC(C)(C)OC(=O)NCCCCCCn1ncc2c(-c3cc(-c4ccc(NC(=O)N5Cc6ccncc6C5)cc4)nn(CC(F)(F)F)c3=O)cccc21 |
| InChI | InChI=1S/C40H45F3N8O4/c1-4-17-39(2,3)55-38(54)45-18-7-5-6-8-20-50-35-11-9-10-31(33(35)23-46-50)32-21-34(48-51(36(32)52)26-40(41,42)43)27-12-14-30(15-13-27)47-37(53)49-24-28-16-19-44-22-29(28)25-49/h9-16,19,21-23H,4-8,17-18,20,24-26H2,1-3H3,(H,45,54)(H,47,53) |
| InChIKey | MZIWQIZTKAMOCP-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.85 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|