C16H8Br2S — CID 139379845
6,7-dibromonaphtho[1,2-b][1]benzothiole (PubChem CID 139379845) has the molecular formula C16H8Br2S and a molecular weight of 392.12 g/mol. Its IUPAC name is 6,7-dibromonaphtho[1,2-b][1]benzothiole.
| Compound Name | 6,7-dibromonaphtho[1,2-b][1]benzothiole |
|---|---|
| PubChem CID | 139379845 |
| Molecular Formula | C16H8Br2S |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 389.87 |
| IUPAC Name | 6,7-dibromonaphtho[1,2-b][1]benzothiole |
| SMILES | Brc1cccc2sc3c4ccccc4cc(Br)c3c12 |
| InChI | InChI=1S/C16H8Br2S/c17-11-6-3-7-13-14(11)15-12(18)8-9-4-1-2-5-10(9)16(15)19-13/h1-8H |
| InChIKey | IMGVIJBIXAIDCS-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |