C41H25N3S — CID 139381762
4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophen-3-yl]benzonitrile (PubChem CID 139381762) has the molecular formula C41H25N3S and a molecular weight of 591.74 g/mol. Its IUPAC name is 4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophen-3-yl]benzonitrile.
| Compound Name | 4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 139381762 |
| Molecular Formula | C41H25N3S |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophen-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(sc4ccccc43)c2-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C41H25N3S/c42-26-27-15-17-28(18-16-27)33-23-24-35-34-13-7-8-14-38(34)45-40(35)39(33)31-21-19-30(20-22-31)37-25-36(29-9-3-1-4-10-29)43-41(44-37)32-11-5-2-6-12-32/h1-25H |
| InChIKey | FJDNKNLOTRRRBS-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |