C50H36N4S — CID 142453273
(1Z,3Z)-1-[4-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophen-4-yl]phenyl]-4-phenylbuta-1,3-diene-1,4-diamine (PubChem CID 142453273) has the molecular formula C50H36N4S and a molecular weight of 724.93 g/mol. Its IUPAC name is (1Z,3Z)-1-[4-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophen-4-yl]phenyl]-4-phenylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1-[4-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophen-4-yl]phenyl]-4-phenylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 142453273 |
| Molecular Formula | C50H36N4S |
| Molecular Weight | 724.93 g/mol |
| Exact Mass | 724.27 |
| IUPAC Name | (1Z,3Z)-1-[4-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophen-4-yl]phenyl]-4-phenylbuta-1,3-diene-1,4-diamine |
| SMILES | N/C(=C\C=C(/N)c1ccc(-c2c(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)ccc3c2sc2ccccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C50H36N4S/c51-43(34-12-4-1-5-13-34)30-31-44(52)35-22-26-38(27-23-35)48-40(28-29-42-41-18-10-11-19-47(41)55-49(42)48)33-20-24-37(25-21-33)46-32-45(36-14-6-2-7-15-36)53-50(54-46)39-16-8-3-9-17-39/h1-32H,51-52H2/b43-30-,44-31- |
| InChIKey | LRIOGOFVCSVHRO-HKWZYNDUSA-N |
| XLogP | 12.48 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.93 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|