C17H18N2S — CID 139382525
5-(8-tert-butylisoquinolin-3-yl)-2-methyl-1,3-thiazole (PubChem CID 139382525) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 5-(8-tert-butylisoquinolin-3-yl)-2-methyl-1,3-thiazole.
| Compound Name | 5-(8-tert-butylisoquinolin-3-yl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 139382525 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 5-(8-tert-butylisoquinolin-3-yl)-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(-c2cc3cccc(C(C)(C)C)c3cn2)s1 |
| InChI | InChI=1S/C17H18N2S/c1-11-18-10-16(20-11)15-8-12-6-5-7-14(17(2,3)4)13(12)9-19-15/h5-10H,1-4H3 |
| InChIKey | REIRTAFTITWMSU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |