C11H17N3O3 — CID 139382770
2-(7-ethyl-3,6-dioxo-2,7-diazaspiro[3.5]nonan-2-yl)acetamide (PubChem CID 139382770) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(7-ethyl-3,6-dioxo-2,7-diazaspiro[3.5]nonan-2-yl)acetamide.
| Compound Name | 2-(7-ethyl-3,6-dioxo-2,7-diazaspiro[3.5]nonan-2-yl)acetamide |
|---|---|
| PubChem CID | 139382770 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-(7-ethyl-3,6-dioxo-2,7-diazaspiro[3.5]nonan-2-yl)acetamide |
| SMILES | CCN1CCC2(CC1=O)CN(CC(N)=O)C2=O |
| InChI | InChI=1S/C11H17N3O3/c1-2-13-4-3-11(5-9(13)16)7-14(10(11)17)6-8(12)15/h2-7H2,1H3,(H2,12,15) |
| InChIKey | LHVSJPMIHUYJJE-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |