C22H35N3O3 — CID 139383471
4-[2-[[ethyl(oxan-3-yl)amino]methyl]-1-methoxy-6-methylcyclohexyl]pyridine-2-carboxamide (PubChem CID 139383471) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is 4-[2-[[ethyl(oxan-3-yl)amino]methyl]-1-methoxy-6-methylcyclohexyl]pyridine-2-carboxamide.
| Compound Name | 4-[2-[[ethyl(oxan-3-yl)amino]methyl]-1-methoxy-6-methylcyclohexyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139383471 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 4-[2-[[ethyl(oxan-3-yl)amino]methyl]-1-methoxy-6-methylcyclohexyl]pyridine-2-carboxamide |
| SMILES | CCN(CC1CCCC(C)C1(OC)c1ccnc(C(N)=O)c1)C1CCCOC1 |
| InChI | InChI=1S/C22H35N3O3/c1-4-25(19-9-6-12-28-15-19)14-18-8-5-7-16(2)22(18,27-3)17-10-11-24-20(13-17)21(23)26/h10-11,13,16,18-19H,4-9,12,14-15H2,1-3H3,(H2,23,26) |
| InChIKey | GMOFQFJSCVMBRD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |