C4H7NO2 — CID 139383676
N-[(1R,2R)-2-hydroxycyclopropyl]formamide (PubChem CID 139383676) has the molecular formula C4H7NO2 and a molecular weight of 101.10 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclopropyl]formamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclopropyl]formamide |
|---|---|
| PubChem CID | 139383676 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclopropyl]formamide |
| SMILES | O=CN[C@@H]1C[C@H]1O |
| InChI | InChI=1S/C4H7NO2/c6-2-5-3-1-4(3)7/h2-4,7H,1H2,(H,5,6)/t3-,4-/m1/s1 |
| InChIKey | SUBZTNUBIUPGHH-QWWZWVQMSA-N |
| XLogP | -1.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|