C18H21FN4O2 — CID 139383917
2-[4-(4-fluoro-2-pyrimidin-4-ylphenoxy)piperidin-1-yl]-N-methylacetamide (PubChem CID 139383917) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[4-(4-fluoro-2-pyrimidin-4-ylphenoxy)piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-(4-fluoro-2-pyrimidin-4-ylphenoxy)piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 139383917 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[4-(4-fluoro-2-pyrimidin-4-ylphenoxy)piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(Oc2ccc(F)cc2-c2ccncn2)CC1 |
| InChI | InChI=1S/C18H21FN4O2/c1-20-18(24)11-23-8-5-14(6-9-23)25-17-3-2-13(19)10-15(17)16-4-7-21-12-22-16/h2-4,7,10,12,14H,5-6,8-9,11H2,1H3,(H,20,24) |
| InChIKey | LMGURWGWRIDOJG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |