C20H23N5O2 — CID 139384078
3-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-pyrimidin-4-ylphenol (PubChem CID 139384078) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-pyrimidin-4-ylphenol.
| Compound Name | 3-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-pyrimidin-4-ylphenol |
|---|---|
| PubChem CID | 139384078 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-4-pyrimidin-4-ylphenol |
| SMILES | Cn1cc(CN2CCC(Oc3cc(O)ccc3-c3ccncn3)CC2)cn1 |
| InChI | InChI=1S/C20H23N5O2/c1-24-12-15(11-23-24)13-25-8-5-17(6-9-25)27-20-10-16(26)2-3-18(20)19-4-7-21-14-22-19/h2-4,7,10-12,14,17,26H,5-6,8-9,13H2,1H3 |
| InChIKey | LUHLEOLVIQTLNE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |