C25H31N7O2 — CID 50939812
3-methyl-2-[1-[4-(piperazin-1-ylmethyl)phenyl]piperidin-4-yl]oxy-6-pyrimidin-4-ylpyrimidin-4-one (PubChem CID 50939812) has the molecular formula C25H31N7O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 3-methyl-2-[1-[4-(piperazin-1-ylmethyl)phenyl]piperidin-4-yl]oxy-6-pyrimidin-4-ylpyrimidin-4-one.
| Compound Name | 3-methyl-2-[1-[4-(piperazin-1-ylmethyl)phenyl]piperidin-4-yl]oxy-6-pyrimidin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 50939812 |
| Molecular Formula | C25H31N7O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 3-methyl-2-[1-[4-(piperazin-1-ylmethyl)phenyl]piperidin-4-yl]oxy-6-pyrimidin-4-ylpyrimidin-4-one |
| SMILES | Cn1c(OC2CCN(c3ccc(CN4CCNCC4)cc3)CC2)nc(-c2ccncn2)cc1=O |
| InChI | InChI=1S/C25H31N7O2/c1-30-24(33)16-23(22-6-9-27-18-28-22)29-25(30)34-21-7-12-32(13-8-21)20-4-2-19(3-5-20)17-31-14-10-26-11-15-31/h2-6,9,16,18,21,26H,7-8,10-15,17H2,1H3 |
| InChIKey | BBMUGMQIECXEBJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|