C20H29N2O2P — CID 139384206
N-cyclopentyl-5-[2-(oxan-4-ylamino)cyclopropyl]-2-phosphanylbenzamide (PubChem CID 139384206) has the molecular formula C20H29N2O2P and a molecular weight of 360.44 g/mol. Its IUPAC name is N-cyclopentyl-5-[2-(oxan-4-ylamino)cyclopropyl]-2-phosphanylbenzamide.
| Compound Name | N-cyclopentyl-5-[2-(oxan-4-ylamino)cyclopropyl]-2-phosphanylbenzamide |
|---|---|
| PubChem CID | 139384206 |
| Molecular Formula | C20H29N2O2P |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-cyclopentyl-5-[2-(oxan-4-ylamino)cyclopropyl]-2-phosphanylbenzamide |
| SMILES | O=C(NC1CCCC1)c1cc(C2CC2NC2CCOCC2)ccc1P |
| InChI | InChI=1S/C20H29N2O2P/c23-20(22-14-3-1-2-4-14)17-11-13(5-6-19(17)25)16-12-18(16)21-15-7-9-24-10-8-15/h5-6,11,14-16,18,21H,1-4,7-10,12,25H2,(H,22,23) |
| InChIKey | RRIYXYFSOQFBBH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|