C14H14F3N3O4 — CID 139384568
2-[[3-cyano-4-(trifluoromethoxy)phenyl]carbamoylamino]-2-methylbutanoic acid (PubChem CID 139384568) has the molecular formula C14H14F3N3O4 and a molecular weight of 345.28 g/mol. Its IUPAC name is 2-[[3-cyano-4-(trifluoromethoxy)phenyl]carbamoylamino]-2-methylbutanoic acid.
| Compound Name | 2-[[3-cyano-4-(trifluoromethoxy)phenyl]carbamoylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 139384568 |
| Molecular Formula | C14H14F3N3O4 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[[3-cyano-4-(trifluoromethoxy)phenyl]carbamoylamino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)Nc1ccc(OC(F)(F)F)c(C#N)c1)C(=O)O |
| InChI | InChI=1S/C14H14F3N3O4/c1-3-13(2,11(21)22)20-12(23)19-9-4-5-10(8(6-9)7-18)24-14(15,16)17/h4-6H,3H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | OXQUPHYTWNEBQJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |