C6H11N3O — CID 139386130
N-(1,5-dimethylpyrazol-3-yl)oxymethanamine (PubChem CID 139386130) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-3-yl)oxymethanamine.
| Compound Name | N-(1,5-dimethylpyrazol-3-yl)oxymethanamine |
|---|---|
| PubChem CID | 139386130 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | N-(1,5-dimethylpyrazol-3-yl)oxymethanamine |
| SMILES | CNOc1cc(C)n(C)n1 |
| InChI | InChI=1S/C6H11N3O/c1-5-4-6(10-7-2)8-9(5)3/h4,7H,1-3H3 |
| InChIKey | DKDIVOPZQXLXGS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|