C18H24N6O2 — CID 139387615
N-(2-amino-4-pyridinyl)-N'-[(1Z)-1-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)ethyl]-2-oxoethanimidamide (PubChem CID 139387615) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-(2-amino-4-pyridinyl)-N'-[(1Z)-1-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)ethyl]-2-oxoethanimidamide.
| Compound Name | N-(2-amino-4-pyridinyl)-N'-[(1Z)-1-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)ethyl]-2-oxoethanimidamide |
|---|---|
| PubChem CID | 139387615 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-(2-amino-4-pyridinyl)-N'-[(1Z)-1-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)ethyl]-2-oxoethanimidamide |
| SMILES | CC(/N=C(\C=O)Nc1ccnc(N)c1)=C1\C(=O)NC2(CCCCC2)N1C |
| InChI | InChI=1S/C18H24N6O2/c1-12(21-15(11-25)22-13-6-9-20-14(19)10-13)16-17(26)23-18(24(16)2)7-4-3-5-8-18/h6,9-11H,3-5,7-8H2,1-2H3,(H,23,26)(H3,19,20,21,22)/b16-12- |
| InChIKey | NDHFRCLELIZVTH-VBKFSLOCSA-N |
| XLogP | 1.63 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|