C13H24N4O3 — CID 139388960
tert-butyl 4-(2-azidoethoxy)-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 139388960) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl 4-(2-azidoethoxy)-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-azidoethoxy)-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139388960 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | tert-butyl 4-(2-azidoethoxy)-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCCN=[N+]=[N-])CC1(C)C |
| InChI | InChI=1S/C13H24N4O3/c1-12(2,3)20-11(18)17-9-10(8-13(17,4)5)19-7-6-15-16-14/h10H,6-9H2,1-5H3 |
| InChIKey | RWWCABVZUBZTDY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|