C16H28N4O3S — CID 139428957
tert-butyl 4-[2-(3-aminosulfanylpyrazol-1-yl)ethoxy]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 139428957) has the molecular formula C16H28N4O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-aminosulfanylpyrazol-1-yl)ethoxy]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-aminosulfanylpyrazol-1-yl)ethoxy]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139428957 |
| Molecular Formula | C16H28N4O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | tert-butyl 4-[2-(3-aminosulfanylpyrazol-1-yl)ethoxy]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCCn2ccc(SN)n2)CC1(C)C |
| InChI | InChI=1S/C16H28N4O3S/c1-15(2,3)23-14(21)20-11-12(10-16(20,4)5)22-9-8-19-7-6-13(18-19)24-17/h6-7,12H,8-11,17H2,1-5H3 |
| InChIKey | ATJXPBQRPSRKIR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|