C21H34N2O3S — CID 139428432
tert-butyl 4-[4-(4-aminosulfanylphenoxy)butyl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 139428432) has the molecular formula C21H34N2O3S and a molecular weight of 394.58 g/mol. Its IUPAC name is tert-butyl 4-[4-(4-aminosulfanylphenoxy)butyl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4-aminosulfanylphenoxy)butyl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139428432 |
| Molecular Formula | C21H34N2O3S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | tert-butyl 4-[4-(4-aminosulfanylphenoxy)butyl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCCCOc2ccc(SN)cc2)CC1(C)C |
| InChI | InChI=1S/C21H34N2O3S/c1-20(2,3)26-19(24)23-15-16(14-21(23,4)5)8-6-7-13-25-17-9-11-18(27-22)12-10-17/h9-12,16H,6-8,13-15,22H2,1-5H3 |
| InChIKey | SPUYBYVGNQCXQS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|